C21H28N2O4S — CID 2131331
(5Z)-5-[(4-butoxy-3-methoxyphenyl)methylidene]-2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-1,3-thiazol-4-one (PubChem CID 2131331) has the molecular formula C21H28N2O4S and a molecular weight of 404.53 g/mol. Its IUPAC name is (5Z)-5-[(4-butoxy-3-methoxyphenyl)methylidene]-2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[(4-butoxy-3-methoxyphenyl)methylidene]-2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 2131331 |
| Molecular Formula | C21H28N2O4S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | (5Z)-5-[(4-butoxy-3-methoxyphenyl)methylidene]-2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-1,3-thiazol-4-one |
| SMILES | CCCCOc1ccc(/C=C2\SC(N3C[C@@H](C)O[C@H](C)C3)=NC2=O)cc1OC |
| InChI | InChI=1S/C21H28N2O4S/c1-5-6-9-26-17-8-7-16(10-18(17)25-4)11-19-20(24)22-21(28-19)23-12-14(2)27-15(3)13-23/h7-8,10-11,14-15H,5-6,9,12-13H2,1-4H3/b19-11-/t14-,15-/m1/s1 |
| InChIKey | LAFBKUGLPHGJCQ-GNTARQNISA-N |
| XLogP | 3.95 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|