C17H19BrN2O3S — CID 7348815
(5E)-5-[(5-bromo-2-methoxyphenyl)methylidene]-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-1,3-thiazol-4-one (PubChem CID 7348815) has the molecular formula C17H19BrN2O3S and a molecular weight of 411.32 g/mol. Its IUPAC name is (5E)-5-[(5-bromo-2-methoxyphenyl)methylidene]-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-1,3-thiazol-4-one.
| Compound Name | (5E)-5-[(5-bromo-2-methoxyphenyl)methylidene]-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 7348815 |
| Molecular Formula | C17H19BrN2O3S |
| Molecular Weight | 411.32 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | (5E)-5-[(5-bromo-2-methoxyphenyl)methylidene]-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-1,3-thiazol-4-one |
| SMILES | COc1ccc(Br)cc1/C=C1/SC(N2C[C@@H](C)O[C@@H](C)C2)=NC1=O |
| InChI | InChI=1S/C17H19BrN2O3S/c1-10-8-20(9-11(2)23-10)17-19-16(21)15(24-17)7-12-6-13(18)4-5-14(12)22-3/h4-7,10-11H,8-9H2,1-3H3/b15-7+/t10-,11+ |
| InChIKey | LZWXPMSBQBHKEF-IPUWSDAOSA-N |
| XLogP | 3.54 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|