C19H17FO4S — CID 84846377
6-fluoro-3-[(2,4,5-trimethoxyphenyl)methylidene]thiochromen-4-one (PubChem CID 84846377) has the molecular formula C19H17FO4S and a molecular weight of 360.41 g/mol. Its IUPAC name is 6-fluoro-3-[(2,4,5-trimethoxyphenyl)methylidene]thiochromen-4-one.
| Compound Name | 6-fluoro-3-[(2,4,5-trimethoxyphenyl)methylidene]thiochromen-4-one |
|---|---|
| PubChem CID | 84846377 |
| Molecular Formula | C19H17FO4S |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 6-fluoro-3-[(2,4,5-trimethoxyphenyl)methylidene]thiochromen-4-one |
| SMILES | COc1cc(OC)c(OC)cc1C=C1CSc2ccc(F)cc2C1=O |
| InChI | InChI=1S/C19H17FO4S/c1-22-15-9-17(24-3)16(23-2)7-11(15)6-12-10-25-18-5-4-13(20)8-14(18)19(12)21/h4-9H,10H2,1-3H3 |
| InChIKey | HMXCEVYWJDKGEX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|