C18H15FO5S — CID 17425582
(3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-8-fluoro-1,1-dioxothiochromen-4-one (PubChem CID 17425582) has the molecular formula C18H15FO5S and a molecular weight of 362.38 g/mol. Its IUPAC name is (3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-8-fluoro-1,1-dioxothiochromen-4-one.
| Compound Name | (3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-8-fluoro-1,1-dioxothiochromen-4-one |
|---|---|
| PubChem CID | 17425582 |
| Molecular Formula | C18H15FO5S |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | (3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-8-fluoro-1,1-dioxothiochromen-4-one |
| SMILES | COc1ccc(/C=C2\CS(=O)(=O)c3c(F)cccc3C2=O)cc1OC |
| InChI | InChI=1S/C18H15FO5S/c1-23-15-7-6-11(9-16(15)24-2)8-12-10-25(21,22)18-13(17(12)20)4-3-5-14(18)19/h3-9H,10H2,1-2H3/b12-8+ |
| InChIKey | VCMIKXBDMIRLNN-XYOKQWHBSA-N |
| XLogP | 2.90 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|