C25H28O9S — CID 118707694
(3E,5Z)-1,1-dioxo-3,5-bis[(3,4,5-trimethoxyphenyl)methylidene]thian-4-one (PubChem CID 118707694) has the molecular formula C25H28O9S and a molecular weight of 504.56 g/mol. Its IUPAC name is (3E,5Z)-1,1-dioxo-3,5-bis[(3,4,5-trimethoxyphenyl)methylidene]thian-4-one.
| Compound Name | (3E,5Z)-1,1-dioxo-3,5-bis[(3,4,5-trimethoxyphenyl)methylidene]thian-4-one |
|---|---|
| PubChem CID | 118707694 |
| Molecular Formula | C25H28O9S |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | (3E,5Z)-1,1-dioxo-3,5-bis[(3,4,5-trimethoxyphenyl)methylidene]thian-4-one |
| SMILES | COc1cc(/C=C2\CS(=O)(=O)C/C(=C/c3cc(OC)c(OC)c(OC)c3)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C25H28O9S/c1-29-19-9-15(10-20(30-2)24(19)33-5)7-17-13-35(27,28)14-18(23(17)26)8-16-11-21(31-3)25(34-6)22(12-16)32-4/h7-12H,13-14H2,1-6H3/b17-7-,18-8+ |
| InChIKey | GFYQSBGGIWTMRS-ZZDPWUPLSA-N |
| XLogP | 3.20 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|