C25H30NO10P — CID 52947975
[(3E,5E)-4-oxo-3,5-bis[(3,4,5-trimethoxyphenyl)methylidene]piperidin-1-yl]phosphonic acid (PubChem CID 52947975) has the molecular formula C25H30NO10P and a molecular weight of 535.49 g/mol. Its IUPAC name is [(3E,5E)-4-oxo-3,5-bis[(3,4,5-trimethoxyphenyl)methylidene]piperidin-1-yl]phosphonic acid.
| Compound Name | [(3E,5E)-4-oxo-3,5-bis[(3,4,5-trimethoxyphenyl)methylidene]piperidin-1-yl]phosphonic acid |
|---|---|
| PubChem CID | 52947975 |
| Molecular Formula | C25H30NO10P |
| Molecular Weight | 535.49 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | [(3E,5E)-4-oxo-3,5-bis[(3,4,5-trimethoxyphenyl)methylidene]piperidin-1-yl]phosphonic acid |
| SMILES | COc1cc(/C=C2\CN(P(=O)(O)O)C/C(=C\c3cc(OC)c(OC)c(OC)c3)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C25H30NO10P/c1-31-19-9-15(10-20(32-2)24(19)35-5)7-17-13-26(37(28,29)30)14-18(23(17)27)8-16-11-21(33-3)25(36-6)22(12-16)34-4/h7-12H,13-14H2,1-6H3,(H2,28,29,30)/b17-7+,18-8+ |
| InChIKey | HXBAJCJVGASJTO-ZEELXFFVSA-N |
| XLogP | 3.18 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|