C30H30N2O7S — CID 175442751
N-[4-[3-benzylidene-4-oxo-5-[(3,4,5-trimethoxyphenyl)methylidene]piperidin-1-yl]sulfonylphenyl]acetamide (PubChem CID 175442751) has the molecular formula C30H30N2O7S and a molecular weight of 562.64 g/mol. Its IUPAC name is N-[4-[3-benzylidene-4-oxo-5-[(3,4,5-trimethoxyphenyl)methylidene]piperidin-1-yl]sulfonylphenyl]acetamide.
| Compound Name | N-[4-[3-benzylidene-4-oxo-5-[(3,4,5-trimethoxyphenyl)methylidene]piperidin-1-yl]sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 175442751 |
| Molecular Formula | C30H30N2O7S |
| Molecular Weight | 562.64 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | N-[4-[3-benzylidene-4-oxo-5-[(3,4,5-trimethoxyphenyl)methylidene]piperidin-1-yl]sulfonylphenyl]acetamide |
| SMILES | COc1cc(C=C2CN(S(=O)(=O)c3ccc(NC(C)=O)cc3)CC(=Cc3ccccc3)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C30H30N2O7S/c1-20(33)31-25-10-12-26(13-11-25)40(35,36)32-18-23(14-21-8-6-5-7-9-21)29(34)24(19-32)15-22-16-27(37-2)30(39-4)28(17-22)38-3/h5-17H,18-19H2,1-4H3,(H,31,33) |
| InChIKey | AZEFDPRTKLSTQE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.64 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|