C21H21NO6S — CID 162666201
(3E)-1-(benzenesulfonyl)-3-[(3,4,5-trimethoxyphenyl)methylidene]-2H-pyridin-4-one (PubChem CID 162666201) has the molecular formula C21H21NO6S and a molecular weight of 415.47 g/mol. Its IUPAC name is (3E)-1-(benzenesulfonyl)-3-[(3,4,5-trimethoxyphenyl)methylidene]-2H-pyridin-4-one.
| Compound Name | (3E)-1-(benzenesulfonyl)-3-[(3,4,5-trimethoxyphenyl)methylidene]-2H-pyridin-4-one |
|---|---|
| PubChem CID | 162666201 |
| Molecular Formula | C21H21NO6S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | (3E)-1-(benzenesulfonyl)-3-[(3,4,5-trimethoxyphenyl)methylidene]-2H-pyridin-4-one |
| SMILES | COc1cc(/C=C2\CN(S(=O)(=O)c3ccccc3)C=CC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C21H21NO6S/c1-26-19-12-15(13-20(27-2)21(19)28-3)11-16-14-22(10-9-18(16)23)29(24,25)17-7-5-4-6-8-17/h4-13H,14H2,1-3H3/b16-11+ |
| InChIKey | KEZNHUVHHCPNFH-LFIBNONCSA-N |
| XLogP | 2.88 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|