C28H25FN2O8S — CID 175462837
1-(4-fluorophenyl)sulfonyl-3-[(3-nitrophenyl)methylidene]-5-[(3,4,5-trimethoxyphenyl)methylidene]piperidin-4-one (PubChem CID 175462837) has the molecular formula C28H25FN2O8S and a molecular weight of 568.58 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-3-[(3-nitrophenyl)methylidene]-5-[(3,4,5-trimethoxyphenyl)methylidene]piperidin-4-one.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-3-[(3-nitrophenyl)methylidene]-5-[(3,4,5-trimethoxyphenyl)methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 175462837 |
| Molecular Formula | C28H25FN2O8S |
| Molecular Weight | 568.58 g/mol |
| Exact Mass | 568.13 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-3-[(3-nitrophenyl)methylidene]-5-[(3,4,5-trimethoxyphenyl)methylidene]piperidin-4-one |
| SMILES | COc1cc(C=C2CN(S(=O)(=O)c3ccc(F)cc3)CC(=Cc3cccc([N+](=O)[O-])c3)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C28H25FN2O8S/c1-37-25-14-19(15-26(38-2)28(25)39-3)12-21-17-30(40(35,36)24-9-7-22(29)8-10-24)16-20(27(21)32)11-18-5-4-6-23(13-18)31(33)34/h4-15H,16-17H2,1-3H3 |
| InChIKey | DRFJQZDMOPJBJG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|