C23H26N8O5S — CID 163215342
1-(3-nitrophenyl)sulfonyl-3,5-bis[(1-propan-2-yltriazol-4-yl)methylidene]piperidin-4-one (PubChem CID 163215342) has the molecular formula C23H26N8O5S and a molecular weight of 526.58 g/mol. Its IUPAC name is 1-(3-nitrophenyl)sulfonyl-3,5-bis[(1-propan-2-yltriazol-4-yl)methylidene]piperidin-4-one.
| Compound Name | 1-(3-nitrophenyl)sulfonyl-3,5-bis[(1-propan-2-yltriazol-4-yl)methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 163215342 |
| Molecular Formula | C23H26N8O5S |
| Molecular Weight | 526.58 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | 1-(3-nitrophenyl)sulfonyl-3,5-bis[(1-propan-2-yltriazol-4-yl)methylidene]piperidin-4-one |
| SMILES | CC(C)n1cc(C=C2CN(S(=O)(=O)c3cccc([N+](=O)[O-])c3)CC(=Cc3cn(C(C)C)nn3)C2=O)nn1 |
| InChI | InChI=1S/C23H26N8O5S/c1-15(2)29-13-19(24-26-29)8-17-11-28(37(35,36)22-7-5-6-21(10-22)31(33)34)12-18(23(17)32)9-20-14-30(16(3)4)27-25-20/h5-10,13-16H,11-12H2,1-4H3 |
| InChIKey | XECGBTBTACXHJU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 159.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.58 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|