C11H11N3O7S — CID 134117265
2-(3-nitrophenyl)sulfonyl-4-propan-2-yl-1,2,4-oxadiazolidine-3,5-dione (PubChem CID 134117265) has the molecular formula C11H11N3O7S and a molecular weight of 329.29 g/mol. Its IUPAC name is 2-(3-nitrophenyl)sulfonyl-4-propan-2-yl-1,2,4-oxadiazolidine-3,5-dione.
| Compound Name | 2-(3-nitrophenyl)sulfonyl-4-propan-2-yl-1,2,4-oxadiazolidine-3,5-dione |
|---|---|
| PubChem CID | 134117265 |
| Molecular Formula | C11H11N3O7S |
| Molecular Weight | 329.29 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 2-(3-nitrophenyl)sulfonyl-4-propan-2-yl-1,2,4-oxadiazolidine-3,5-dione |
| SMILES | CC(C)n1c(=O)on(S(=O)(=O)c2cccc([N+](=O)[O-])c2)c1=O |
| InChI | InChI=1S/C11H11N3O7S/c1-7(2)12-10(15)14(21-11(12)16)22(19,20)9-5-3-4-8(6-9)13(17)18/h3-7H,1-2H3 |
| InChIKey | NDCGCOXJNAGXLL-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 134.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.29 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|