C25H18F2N2O6S — CID 162660738
[4-[(3E,5E)-3,5-bis[(3-fluorophenyl)methylidene]-4-oxopiperidin-1-yl]sulfonylphenyl] nitrate (PubChem CID 162660738) has the molecular formula C25H18F2N2O6S and a molecular weight of 512.49 g/mol. Its IUPAC name is [4-[(3E,5E)-3,5-bis[(3-fluorophenyl)methylidene]-4-oxopiperidin-1-yl]sulfonylphenyl] nitrate.
| Compound Name | [4-[(3E,5E)-3,5-bis[(3-fluorophenyl)methylidene]-4-oxopiperidin-1-yl]sulfonylphenyl] nitrate |
|---|---|
| PubChem CID | 162660738 |
| Molecular Formula | C25H18F2N2O6S |
| Molecular Weight | 512.49 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | [4-[(3E,5E)-3,5-bis[(3-fluorophenyl)methylidene]-4-oxopiperidin-1-yl]sulfonylphenyl] nitrate |
| SMILES | O=C1/C(=C/c2cccc(F)c2)CN(S(=O)(=O)c2ccc(O[N+](=O)[O-])cc2)C/C1=C\c1cccc(F)c1 |
| InChI | InChI=1S/C25H18F2N2O6S/c26-21-5-1-3-17(13-21)11-19-15-28(16-20(25(19)30)12-18-4-2-6-22(27)14-18)36(33,34)24-9-7-23(8-10-24)35-29(31)32/h1-14H,15-16H2/b19-11+,20-12+ |
| InChIKey | FIZFABVGHGLXKZ-AYKLPDECSA-N |
| XLogP | 4.28 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|