C26H18F2N2O3S — CID 162661220
4-[(3E,5E)-3,5-bis[(4-fluorophenyl)methylidene]-4-oxopiperidin-1-yl]sulfonylbenzonitrile (PubChem CID 162661220) has the molecular formula C26H18F2N2O3S and a molecular weight of 476.50 g/mol. Its IUPAC name is 4-[(3E,5E)-3,5-bis[(4-fluorophenyl)methylidene]-4-oxopiperidin-1-yl]sulfonylbenzonitrile.
| Compound Name | 4-[(3E,5E)-3,5-bis[(4-fluorophenyl)methylidene]-4-oxopiperidin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 162661220 |
| Molecular Formula | C26H18F2N2O3S |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 4-[(3E,5E)-3,5-bis[(4-fluorophenyl)methylidene]-4-oxopiperidin-1-yl]sulfonylbenzonitrile |
| SMILES | N#Cc1ccc(S(=O)(=O)N2C/C(=C\c3ccc(F)cc3)C(=O)/C(=C/c3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C26H18F2N2O3S/c27-23-7-1-18(2-8-23)13-21-16-30(34(32,33)25-11-5-20(15-29)6-12-25)17-22(26(21)31)14-19-3-9-24(28)10-4-19/h1-14H,16-17H2/b21-13+,22-14+ |
| InChIKey | QUAAQTXUBDENSO-JFMUQQRKSA-N |
| XLogP | 4.58 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|