C25H18FN3O3S — CID 155524271
4-[(3E,5E)-3-[(2-fluorophenyl)methylidene]-4-oxo-5-(pyridin-3-ylmethylidene)piperidin-1-yl]sulfonylbenzonitrile (PubChem CID 155524271) has the molecular formula C25H18FN3O3S and a molecular weight of 459.50 g/mol. Its IUPAC name is 4-[(3E,5E)-3-[(2-fluorophenyl)methylidene]-4-oxo-5-(pyridin-3-ylmethylidene)piperidin-1-yl]sulfonylbenzonitrile.
| Compound Name | 4-[(3E,5E)-3-[(2-fluorophenyl)methylidene]-4-oxo-5-(pyridin-3-ylmethylidene)piperidin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 155524271 |
| Molecular Formula | C25H18FN3O3S |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 4-[(3E,5E)-3-[(2-fluorophenyl)methylidene]-4-oxo-5-(pyridin-3-ylmethylidene)piperidin-1-yl]sulfonylbenzonitrile |
| SMILES | N#Cc1ccc(S(=O)(=O)N2C/C(=C\c3cccnc3)C(=O)/C(=C/c3ccccc3F)C2)cc1 |
| InChI | InChI=1S/C25H18FN3O3S/c26-24-6-2-1-5-20(24)13-22-17-29(33(31,32)23-9-7-18(14-27)8-10-23)16-21(25(22)30)12-19-4-3-11-28-15-19/h1-13,15H,16-17H2/b21-12+,22-13+ |
| InChIKey | WVEYECUBRWAZLV-ADYPVIEZSA-N |
| XLogP | 3.83 |
| TPSA | 91.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|