C25H18F4N2O3S — CID 155561364
(3E,5E)-3-[(2-fluorophenyl)methylidene]-5-(pyridin-3-ylmethylidene)-1-[4-(trifluoromethyl)phenyl]sulfonylpiperidin-4-one (PubChem CID 155561364) has the molecular formula C25H18F4N2O3S and a molecular weight of 502.49 g/mol. Its IUPAC name is (3E,5E)-3-[(2-fluorophenyl)methylidene]-5-(pyridin-3-ylmethylidene)-1-[4-(trifluoromethyl)phenyl]sulfonylpiperidin-4-one.
| Compound Name | (3E,5E)-3-[(2-fluorophenyl)methylidene]-5-(pyridin-3-ylmethylidene)-1-[4-(trifluoromethyl)phenyl]sulfonylpiperidin-4-one |
|---|---|
| PubChem CID | 155561364 |
| Molecular Formula | C25H18F4N2O3S |
| Molecular Weight | 502.49 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | (3E,5E)-3-[(2-fluorophenyl)methylidene]-5-(pyridin-3-ylmethylidene)-1-[4-(trifluoromethyl)phenyl]sulfonylpiperidin-4-one |
| SMILES | O=C1/C(=C/c2cccnc2)CN(S(=O)(=O)c2ccc(C(F)(F)F)cc2)C/C1=C\c1ccccc1F |
| InChI | InChI=1S/C25H18F4N2O3S/c26-23-6-2-1-5-18(23)13-20-16-31(15-19(24(20)32)12-17-4-3-11-30-14-17)35(33,34)22-9-7-21(8-10-22)25(27,28)29/h1-14H,15-16H2/b19-12+,20-13+ |
| InChIKey | OVGYMONXBYAGTI-KVOOEGMKSA-N |
| XLogP | 4.98 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|