C23H18BrFN2O3S — CID 163364315
1-(4-bromophenyl)sulfonyl-3-[(2-fluorophenyl)methylidene]-5-pyridin-3-ylpiperidin-4-one (PubChem CID 163364315) has the molecular formula C23H18BrFN2O3S and a molecular weight of 501.38 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfonyl-3-[(2-fluorophenyl)methylidene]-5-pyridin-3-ylpiperidin-4-one.
| Compound Name | 1-(4-bromophenyl)sulfonyl-3-[(2-fluorophenyl)methylidene]-5-pyridin-3-ylpiperidin-4-one |
|---|---|
| PubChem CID | 163364315 |
| Molecular Formula | C23H18BrFN2O3S |
| Molecular Weight | 501.38 g/mol |
| Exact Mass | 500.02 |
| IUPAC Name | 1-(4-bromophenyl)sulfonyl-3-[(2-fluorophenyl)methylidene]-5-pyridin-3-ylpiperidin-4-one |
| SMILES | O=C1C(=Cc2ccccc2F)CN(S(=O)(=O)c2ccc(Br)cc2)CC1c1cccnc1 |
| InChI | InChI=1S/C23H18BrFN2O3S/c24-19-7-9-20(10-8-19)31(29,30)27-14-18(12-16-4-1-2-6-22(16)25)23(28)21(15-27)17-5-3-11-26-13-17/h1-13,21H,14-15H2 |
| InChIKey | KCFQZIGKUKBWEH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|