C26H19F4NO3S — CID 78158196
3,5-bis[(3,5-difluorophenyl)methylidene]-1-(4-methylphenyl)sulfonylpiperidin-4-one (PubChem CID 78158196) has the molecular formula C26H19F4NO3S and a molecular weight of 501.50 g/mol. Its IUPAC name is 3,5-bis[(3,5-difluorophenyl)methylidene]-1-(4-methylphenyl)sulfonylpiperidin-4-one.
| Compound Name | 3,5-bis[(3,5-difluorophenyl)methylidene]-1-(4-methylphenyl)sulfonylpiperidin-4-one |
|---|---|
| PubChem CID | 78158196 |
| Molecular Formula | C26H19F4NO3S |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | 3,5-bis[(3,5-difluorophenyl)methylidene]-1-(4-methylphenyl)sulfonylpiperidin-4-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(=Cc3cc(F)cc(F)c3)C(=O)C(=Cc3cc(F)cc(F)c3)C2)cc1 |
| InChI | InChI=1S/C26H19F4NO3S/c1-16-2-4-25(5-3-16)35(33,34)31-14-19(6-17-8-21(27)12-22(28)9-17)26(32)20(15-31)7-18-10-23(29)13-24(30)11-18/h2-13H,14-15H2,1H3 |
| InChIKey | VEOCDYGHNCQFKS-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|