C28H27NO3S — CID 73050935
(3E,5E)-3,5-bis[(4-methylphenyl)methylidene]-1-(4-methylphenyl)sulfonylpiperidin-4-one (PubChem CID 73050935) has the molecular formula C28H27NO3S and a molecular weight of 457.60 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[(4-methylphenyl)methylidene]-1-(4-methylphenyl)sulfonylpiperidin-4-one.
| Compound Name | (3E,5E)-3,5-bis[(4-methylphenyl)methylidene]-1-(4-methylphenyl)sulfonylpiperidin-4-one |
|---|---|
| PubChem CID | 73050935 |
| Molecular Formula | C28H27NO3S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | (3E,5E)-3,5-bis[(4-methylphenyl)methylidene]-1-(4-methylphenyl)sulfonylpiperidin-4-one |
| SMILES | Cc1ccc(/C=C2\CN(S(=O)(=O)c3ccc(C)cc3)C/C(=C\c3ccc(C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C28H27NO3S/c1-20-4-10-23(11-5-20)16-25-18-29(33(31,32)27-14-8-22(3)9-15-27)19-26(28(25)30)17-24-12-6-21(2)7-13-24/h4-17H,18-19H2,1-3H3/b25-16+,26-17+ |
| InChIKey | ZZIUCAJUVWTSTA-ZZZAPRPPSA-N |
| XLogP | 5.35 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|