C25H25NO2S — CID 10787364
(1E)-1-benzylidene-3-(4-methylphenyl)sulfonyl-2,4,5,6-tetrahydro-3-benzazocine (PubChem CID 10787364) has the molecular formula C25H25NO2S and a molecular weight of 403.55 g/mol. Its IUPAC name is (1E)-1-benzylidene-3-(4-methylphenyl)sulfonyl-2,4,5,6-tetrahydro-3-benzazocine.
| Compound Name | (1E)-1-benzylidene-3-(4-methylphenyl)sulfonyl-2,4,5,6-tetrahydro-3-benzazocine |
|---|---|
| PubChem CID | 10787364 |
| Molecular Formula | C25H25NO2S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | (1E)-1-benzylidene-3-(4-methylphenyl)sulfonyl-2,4,5,6-tetrahydro-3-benzazocine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCc3ccccc3/C(=C\c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C25H25NO2S/c1-20-13-15-24(16-14-20)29(27,28)26-17-7-11-22-10-5-6-12-25(22)23(19-26)18-21-8-3-2-4-9-21/h2-6,8-10,12-16,18H,7,11,17,19H2,1H3/b23-18- |
| InChIKey | NLVOHWZFFCXUGX-NKFKGCMQSA-N |
| XLogP | 5.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|