C16H16BrNO2S — CID 63158077
2-(4-bromophenyl)sulfonyl-1,3,4,5-tetrahydro-2-benzazepine (PubChem CID 63158077) has the molecular formula C16H16BrNO2S and a molecular weight of 366.28 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfonyl-1,3,4,5-tetrahydro-2-benzazepine.
| Compound Name | 2-(4-bromophenyl)sulfonyl-1,3,4,5-tetrahydro-2-benzazepine |
|---|---|
| PubChem CID | 63158077 |
| Molecular Formula | C16H16BrNO2S |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | 2-(4-bromophenyl)sulfonyl-1,3,4,5-tetrahydro-2-benzazepine |
| SMILES | O=S(=O)(c1ccc(Br)cc1)N1CCCc2ccccc2C1 |
| InChI | InChI=1S/C16H16BrNO2S/c17-15-7-9-16(10-8-15)21(19,20)18-11-3-6-13-4-1-2-5-14(13)12-18/h1-2,4-5,7-10H,3,6,11-12H2 |
| InChIKey | OIYZCRKPOSRUCE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |