C32H35NO3S — CID 123255053
1-(4-methylphenyl)sulfonyl-3,5-bis[(4-propan-2-ylphenyl)methylidene]piperidin-4-one (PubChem CID 123255053) has the molecular formula C32H35NO3S and a molecular weight of 513.70 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-3,5-bis[(4-propan-2-ylphenyl)methylidene]piperidin-4-one.
| Compound Name | 1-(4-methylphenyl)sulfonyl-3,5-bis[(4-propan-2-ylphenyl)methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 123255053 |
| Molecular Formula | C32H35NO3S |
| Molecular Weight | 513.70 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-3,5-bis[(4-propan-2-ylphenyl)methylidene]piperidin-4-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(=Cc3ccc(C(C)C)cc3)C(=O)C(=Cc3ccc(C(C)C)cc3)C2)cc1 |
| InChI | InChI=1S/C32H35NO3S/c1-22(2)27-12-8-25(9-13-27)18-29-20-33(37(35,36)31-16-6-24(5)7-17-31)21-30(32(29)34)19-26-10-14-28(15-11-26)23(3)4/h6-19,22-23H,20-21H2,1-5H3 |
| InChIKey | RWKPGJSJGOKEOL-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.70 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|