C25H19Cl2NO3S — CID 118107910
(3Z,5E)-1-(benzenesulfonyl)-3,5-bis[(4-chlorophenyl)methylidene]piperidin-4-one (PubChem CID 118107910) has the molecular formula C25H19Cl2NO3S and a molecular weight of 484.40 g/mol. Its IUPAC name is (3Z,5E)-1-(benzenesulfonyl)-3,5-bis[(4-chlorophenyl)methylidene]piperidin-4-one.
| Compound Name | (3Z,5E)-1-(benzenesulfonyl)-3,5-bis[(4-chlorophenyl)methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 118107910 |
| Molecular Formula | C25H19Cl2NO3S |
| Molecular Weight | 484.40 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | (3Z,5E)-1-(benzenesulfonyl)-3,5-bis[(4-chlorophenyl)methylidene]piperidin-4-one |
| SMILES | O=C1/C(=C\c2ccc(Cl)cc2)CN(S(=O)(=O)c2ccccc2)C/C1=C\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H19Cl2NO3S/c26-22-10-6-18(7-11-22)14-20-16-28(32(30,31)24-4-2-1-3-5-24)17-21(25(20)29)15-19-8-12-23(27)13-9-19/h1-15H,16-17H2/b20-14-,21-15+ |
| InChIKey | MJTJDPWXERIXOY-TVGQLCNQSA-N |
| XLogP | 5.73 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.40 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|