C20H16F4N2O — CID 175456918
(3E)-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methylidene]-1-methyl-5-(pyridin-3-ylmethylidene)piperidin-4-one (PubChem CID 175456918) has the molecular formula C20H16F4N2O and a molecular weight of 376.35 g/mol. Its IUPAC name is (3E)-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methylidene]-1-methyl-5-(pyridin-3-ylmethylidene)piperidin-4-one.
| Compound Name | (3E)-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methylidene]-1-methyl-5-(pyridin-3-ylmethylidene)piperidin-4-one |
|---|---|
| PubChem CID | 175456918 |
| Molecular Formula | C20H16F4N2O |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | (3E)-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methylidene]-1-methyl-5-(pyridin-3-ylmethylidene)piperidin-4-one |
| SMILES | CN1CC(=Cc2cccnc2)C(=O)/C(=C/c2ccc(F)cc2C(F)(F)F)C1 |
| InChI | InChI=1S/C20H16F4N2O/c1-26-11-15(7-13-3-2-6-25-10-13)19(27)16(12-26)8-14-4-5-17(21)9-18(14)20(22,23)24/h2-10H,11-12H2,1H3/b15-7?,16-8+ |
| InChIKey | VWCYKNKSSLCLGF-IJBGJYQBSA-N |
| XLogP | 4.22 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|