C24H27NO — CID 3872837
3,5-bis[(2,4-dimethylphenyl)methylidene]-1-methylpiperidin-4-one (PubChem CID 3872837) has the molecular formula C24H27NO and a molecular weight of 345.49 g/mol. Its IUPAC name is 3,5-bis[(2,4-dimethylphenyl)methylidene]-1-methylpiperidin-4-one.
| Compound Name | 3,5-bis[(2,4-dimethylphenyl)methylidene]-1-methylpiperidin-4-one |
|---|---|
| PubChem CID | 3872837 |
| Molecular Formula | C24H27NO |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 3,5-bis[(2,4-dimethylphenyl)methylidene]-1-methylpiperidin-4-one |
| SMILES | Cc1ccc(C=C2CN(C)CC(=Cc3ccc(C)cc3C)C2=O)c(C)c1 |
| InChI | InChI=1S/C24H27NO/c1-16-6-8-20(18(3)10-16)12-22-14-25(5)15-23(24(22)26)13-21-9-7-17(2)11-19(21)4/h6-13H,14-15H2,1-5H3 |
| InChIKey | HXSCPXCKEDXDKT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|