C28H27N5O — CID 3470720
1-methyl-3,5-bis[(3-methyl-1-phenylpyrazol-4-yl)methylidene]piperidin-4-one (PubChem CID 3470720) has the molecular formula C28H27N5O and a molecular weight of 449.56 g/mol. Its IUPAC name is 1-methyl-3,5-bis[(3-methyl-1-phenylpyrazol-4-yl)methylidene]piperidin-4-one.
| Compound Name | 1-methyl-3,5-bis[(3-methyl-1-phenylpyrazol-4-yl)methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 3470720 |
| Molecular Formula | C28H27N5O |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 1-methyl-3,5-bis[(3-methyl-1-phenylpyrazol-4-yl)methylidene]piperidin-4-one |
| SMILES | Cc1nn(-c2ccccc2)cc1C=C1CN(C)CC(=Cc2cn(-c3ccccc3)nc2C)C1=O |
| InChI | InChI=1S/C28H27N5O/c1-20-22(18-32(29-20)26-10-6-4-7-11-26)14-24-16-31(3)17-25(28(24)34)15-23-19-33(30-21(23)2)27-12-8-5-9-13-27/h4-15,18-19H,16-17H2,1-3H3 |
| InChIKey | JNJSCPZYJOASTQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|