C37H30N6O — CID 4201964
4-methyl-2,6-bis[(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)methylidene]cyclohexan-1-one (PubChem CID 4201964) has the molecular formula C37H30N6O and a molecular weight of 574.69 g/mol. Its IUPAC name is 4-methyl-2,6-bis[(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)methylidene]cyclohexan-1-one.
| Compound Name | 4-methyl-2,6-bis[(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 4201964 |
| Molecular Formula | C37H30N6O |
| Molecular Weight | 574.69 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | 4-methyl-2,6-bis[(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)methylidene]cyclohexan-1-one |
| SMILES | CC1CC(=Cc2cn(-c3ccccc3)nc2-c2cccnc2)C(=O)C(=Cc2cn(-c3ccccc3)nc2-c2cccnc2)C1 |
| InChI | InChI=1S/C37H30N6O/c1-26-18-29(20-31-24-42(33-12-4-2-5-13-33)40-35(31)27-10-8-16-38-22-27)37(44)30(19-26)21-32-25-43(34-14-6-3-7-15-34)41-36(32)28-11-9-17-39-23-28/h2-17,20-26H,18-19H2,1H3 |
| InChIKey | RZPKJFQZJLUNSL-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.69 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|