C16H10FN3O2S — CID 141403376
5-(2-fluorophenyl)-1-pyridin-3-ylsulfonylpyrrole-3-carbonitrile (PubChem CID 141403376) has the molecular formula C16H10FN3O2S and a molecular weight of 327.34 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-1-pyridin-3-ylsulfonylpyrrole-3-carbonitrile.
| Compound Name | 5-(2-fluorophenyl)-1-pyridin-3-ylsulfonylpyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 141403376 |
| Molecular Formula | C16H10FN3O2S |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 5-(2-fluorophenyl)-1-pyridin-3-ylsulfonylpyrrole-3-carbonitrile |
| SMILES | N#Cc1cc(-c2ccccc2F)n(S(=O)(=O)c2cccnc2)c1 |
| InChI | InChI=1S/C16H10FN3O2S/c17-15-6-2-1-5-14(15)16-8-12(9-18)11-20(16)23(21,22)13-4-3-7-19-10-13/h1-8,10-11H |
| InChIKey | PZUUKJCBWCBPQJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |