C19H17FN2O3S — CID 178134549
[4-cyclopropyl-5-(2-fluorophenyl)-1-pyridin-3-ylsulfonylpyrrol-3-yl]methanol (PubChem CID 178134549) has the molecular formula C19H17FN2O3S and a molecular weight of 372.42 g/mol. Its IUPAC name is [4-cyclopropyl-5-(2-fluorophenyl)-1-pyridin-3-ylsulfonylpyrrol-3-yl]methanol.
| Compound Name | [4-cyclopropyl-5-(2-fluorophenyl)-1-pyridin-3-ylsulfonylpyrrol-3-yl]methanol |
|---|---|
| PubChem CID | 178134549 |
| Molecular Formula | C19H17FN2O3S |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | [4-cyclopropyl-5-(2-fluorophenyl)-1-pyridin-3-ylsulfonylpyrrol-3-yl]methanol |
| SMILES | O=S(=O)(c1cccnc1)n1cc(CO)c(C2CC2)c1-c1ccccc1F |
| InChI | InChI=1S/C19H17FN2O3S/c20-17-6-2-1-5-16(17)19-18(13-7-8-13)14(12-23)11-22(19)26(24,25)15-4-3-9-21-10-15/h1-6,9-11,13,23H,7-8,12H2 |
| InChIKey | VXCOAVXZNOSIIW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |