C14H13FN2O2S — CID 71978636
3-[2-(2-fluorophenyl)azetidin-1-yl]sulfonylpyridine (PubChem CID 71978636) has the molecular formula C14H13FN2O2S and a molecular weight of 292.33 g/mol. Its IUPAC name is 3-[2-(2-fluorophenyl)azetidin-1-yl]sulfonylpyridine.
| Compound Name | 3-[2-(2-fluorophenyl)azetidin-1-yl]sulfonylpyridine |
|---|---|
| PubChem CID | 71978636 |
| Molecular Formula | C14H13FN2O2S |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 3-[2-(2-fluorophenyl)azetidin-1-yl]sulfonylpyridine |
| SMILES | O=S(=O)(c1cccnc1)N1CCC1c1ccccc1F |
| InChI | InChI=1S/C14H13FN2O2S/c15-13-6-2-1-5-12(13)14-7-9-17(14)20(18,19)11-4-3-8-16-10-11/h1-6,8,10,14H,7,9H2 |
| InChIKey | MZWGVIPADUPIAE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |