C14H12FNO4S2 — CID 166213017
4-[2-(2-fluorophenyl)azetidin-1-yl]sulfonylthiophene-2-carboxylic acid (PubChem CID 166213017) has the molecular formula C14H12FNO4S2 and a molecular weight of 341.39 g/mol. Its IUPAC name is 4-[2-(2-fluorophenyl)azetidin-1-yl]sulfonylthiophene-2-carboxylic acid.
| Compound Name | 4-[2-(2-fluorophenyl)azetidin-1-yl]sulfonylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 166213017 |
| Molecular Formula | C14H12FNO4S2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 4-[2-(2-fluorophenyl)azetidin-1-yl]sulfonylthiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)N2CCC2c2ccccc2F)cs1 |
| InChI | InChI=1S/C14H12FNO4S2/c15-11-4-2-1-3-10(11)12-5-6-16(12)22(19,20)9-7-13(14(17)18)21-8-9/h1-4,7-8,12H,5-6H2,(H,17,18) |
| InChIKey | YAFPMYTZTFPDAP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |