C10H14N2O4S2 — CID 55248008
4-(3-aminopiperidin-1-yl)sulfonylthiophene-2-carboxylic acid (PubChem CID 55248008) has the molecular formula C10H14N2O4S2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 4-(3-aminopiperidin-1-yl)sulfonylthiophene-2-carboxylic acid.
| Compound Name | 4-(3-aminopiperidin-1-yl)sulfonylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 55248008 |
| Molecular Formula | C10H14N2O4S2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 4-(3-aminopiperidin-1-yl)sulfonylthiophene-2-carboxylic acid |
| SMILES | NC1CCCN(S(=O)(=O)c2csc(C(=O)O)c2)C1 |
| InChI | InChI=1S/C10H14N2O4S2/c11-7-2-1-3-12(5-7)18(15,16)8-4-9(10(13)14)17-6-8/h4,6-7H,1-3,5,11H2,(H,13,14) |
| InChIKey | CAJVRTOSSBKXKQ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |