C13H18N2O4S2 — CID 61063212
4-[4-(cyclopropylmethyl)piperazin-1-yl]sulfonylthiophene-2-carboxylic acid (PubChem CID 61063212) has the molecular formula C13H18N2O4S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 4-[4-(cyclopropylmethyl)piperazin-1-yl]sulfonylthiophene-2-carboxylic acid.
| Compound Name | 4-[4-(cyclopropylmethyl)piperazin-1-yl]sulfonylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 61063212 |
| Molecular Formula | C13H18N2O4S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 4-[4-(cyclopropylmethyl)piperazin-1-yl]sulfonylthiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)N2CCN(CC3CC3)CC2)cs1 |
| InChI | InChI=1S/C13H18N2O4S2/c16-13(17)12-7-11(9-20-12)21(18,19)15-5-3-14(4-6-15)8-10-1-2-10/h7,9-10H,1-6,8H2,(H,16,17) |
| InChIKey | HNHJBTFJPVFFDV-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |