C11H14FNO2S — CID 51694778
(2R)-2-(2-fluorophenyl)-1-methylsulfonylpyrrolidine (PubChem CID 51694778) has the molecular formula C11H14FNO2S and a molecular weight of 243.30 g/mol. Its IUPAC name is (2R)-2-(2-fluorophenyl)-1-methylsulfonylpyrrolidine.
| Compound Name | (2R)-2-(2-fluorophenyl)-1-methylsulfonylpyrrolidine |
|---|---|
| PubChem CID | 51694778 |
| Molecular Formula | C11H14FNO2S |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | (2R)-2-(2-fluorophenyl)-1-methylsulfonylpyrrolidine |
| SMILES | CS(=O)(=O)N1CCC[C@@H]1c1ccccc1F |
| InChI | InChI=1S/C11H14FNO2S/c1-16(14,15)13-8-4-7-11(13)9-5-2-3-6-10(9)12/h2-3,5-6,11H,4,7-8H2,1H3/t11-/m1/s1 |
| InChIKey | YICCAKNBFPLYGK-LLVKDONJSA-N |
| XLogP | 1.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |