C18H19F2NO2S — CID 166330262
2-(2,5-difluorophenyl)-1-(2-ethylphenyl)sulfonylpyrrolidine (PubChem CID 166330262) has the molecular formula C18H19F2NO2S and a molecular weight of 351.42 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-1-(2-ethylphenyl)sulfonylpyrrolidine.
| Compound Name | 2-(2,5-difluorophenyl)-1-(2-ethylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 166330262 |
| Molecular Formula | C18H19F2NO2S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 2-(2,5-difluorophenyl)-1-(2-ethylphenyl)sulfonylpyrrolidine |
| SMILES | CCc1ccccc1S(=O)(=O)N1CCCC1c1cc(F)ccc1F |
| InChI | InChI=1S/C18H19F2NO2S/c1-2-13-6-3-4-8-18(13)24(22,23)21-11-5-7-17(21)15-12-14(19)9-10-16(15)20/h3-4,6,8-10,12,17H,2,5,7,11H2,1H3 |
| InChIKey | KLWAQZHHRKDTFX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |