C16H14ClF2NO2S — CID 51855932
(2S)-2-(2-chlorophenyl)-1-(2,5-difluorophenyl)sulfonylpyrrolidine (PubChem CID 51855932) has the molecular formula C16H14ClF2NO2S and a molecular weight of 357.81 g/mol. Its IUPAC name is (2S)-2-(2-chlorophenyl)-1-(2,5-difluorophenyl)sulfonylpyrrolidine.
| Compound Name | (2S)-2-(2-chlorophenyl)-1-(2,5-difluorophenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 51855932 |
| Molecular Formula | C16H14ClF2NO2S |
| Molecular Weight | 357.81 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | (2S)-2-(2-chlorophenyl)-1-(2,5-difluorophenyl)sulfonylpyrrolidine |
| SMILES | O=S(=O)(c1cc(F)ccc1F)N1CCC[C@H]1c1ccccc1Cl |
| InChI | InChI=1S/C16H14ClF2NO2S/c17-13-5-2-1-4-12(13)15-6-3-9-20(15)23(21,22)16-10-11(18)7-8-14(16)19/h1-2,4-5,7-8,10,15H,3,6,9H2/t15-/m0/s1 |
| InChIKey | HVBGPEDTWJOAQI-HNNXBMFYSA-N |
| XLogP | 4.14 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.81 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |