C17H19F2NO2S2 — CID 22586834
1-(2,5-difluorophenyl)sulfonyl-2-(3-methylthiophen-2-yl)azepane (PubChem CID 22586834) has the molecular formula C17H19F2NO2S2 and a molecular weight of 371.47 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)sulfonyl-2-(3-methylthiophen-2-yl)azepane.
| Compound Name | 1-(2,5-difluorophenyl)sulfonyl-2-(3-methylthiophen-2-yl)azepane |
|---|---|
| PubChem CID | 22586834 |
| Molecular Formula | C17H19F2NO2S2 |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 1-(2,5-difluorophenyl)sulfonyl-2-(3-methylthiophen-2-yl)azepane |
| SMILES | Cc1ccsc1C1CCCCCN1S(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C17H19F2NO2S2/c1-12-8-10-23-17(12)15-5-3-2-4-9-20(15)24(21,22)16-11-13(18)6-7-14(16)19/h6-8,10-11,15H,2-5,9H2,1H3 |
| InChIKey | KARQUHSGNDRTAX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |