C13H21NO2S2 — CID 53013040
1-ethylsulfonyl-2-(3-methylthiophen-2-yl)azepane (PubChem CID 53013040) has the molecular formula C13H21NO2S2 and a molecular weight of 287.45 g/mol. Its IUPAC name is 1-ethylsulfonyl-2-(3-methylthiophen-2-yl)azepane.
| Compound Name | 1-ethylsulfonyl-2-(3-methylthiophen-2-yl)azepane |
|---|---|
| PubChem CID | 53013040 |
| Molecular Formula | C13H21NO2S2 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 1-ethylsulfonyl-2-(3-methylthiophen-2-yl)azepane |
| SMILES | CCS(=O)(=O)N1CCCCCC1c1sccc1C |
| InChI | InChI=1S/C13H21NO2S2/c1-3-18(15,16)14-9-6-4-5-7-12(14)13-11(2)8-10-17-13/h8,10,12H,3-7,9H2,1-2H3 |
| InChIKey | CCZPLFKJACBSJG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |