C18H22N2OS — CID 22586846
2-(3-methylthiophen-2-yl)-N-phenylazepane-1-carboxamide (PubChem CID 22586846) has the molecular formula C18H22N2OS and a molecular weight of 314.45 g/mol. Its IUPAC name is 2-(3-methylthiophen-2-yl)-N-phenylazepane-1-carboxamide.
| Compound Name | 2-(3-methylthiophen-2-yl)-N-phenylazepane-1-carboxamide |
|---|---|
| PubChem CID | 22586846 |
| Molecular Formula | C18H22N2OS |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 2-(3-methylthiophen-2-yl)-N-phenylazepane-1-carboxamide |
| SMILES | Cc1ccsc1C1CCCCCN1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H22N2OS/c1-14-11-13-22-17(14)16-10-6-3-7-12-20(16)18(21)19-15-8-4-2-5-9-15/h2,4-5,8-9,11,13,16H,3,6-7,10,12H2,1H3,(H,19,21) |
| InChIKey | NVQMRXJSKQMIIY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |