C15H16F3N3O2S — CID 51855636
1-(difluoromethyl)-4-[(2S)-2-(2-fluorophenyl)pyrrolidin-1-yl]sulfonyl-5-methylpyrazole (PubChem CID 51855636) has the molecular formula C15H16F3N3O2S and a molecular weight of 359.37 g/mol. Its IUPAC name is 1-(difluoromethyl)-4-[(2S)-2-(2-fluorophenyl)pyrrolidin-1-yl]sulfonyl-5-methylpyrazole.
| Compound Name | 1-(difluoromethyl)-4-[(2S)-2-(2-fluorophenyl)pyrrolidin-1-yl]sulfonyl-5-methylpyrazole |
|---|---|
| PubChem CID | 51855636 |
| Molecular Formula | C15H16F3N3O2S |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 1-(difluoromethyl)-4-[(2S)-2-(2-fluorophenyl)pyrrolidin-1-yl]sulfonyl-5-methylpyrazole |
| SMILES | Cc1c(S(=O)(=O)N2CCC[C@H]2c2ccccc2F)cnn1C(F)F |
| InChI | InChI=1S/C15H16F3N3O2S/c1-10-14(9-19-21(10)15(17)18)24(22,23)20-8-4-7-13(20)11-5-2-3-6-12(11)16/h2-3,5-6,9,13,15H,4,7-8H2,1H3/t13-/m0/s1 |
| InChIKey | ZXLSWNZSBQNIJK-ZDUSSCGKSA-N |
| XLogP | 3.25 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |