C16H19N3O3S — CID 124971463
(2S)-2-(2-methoxyphenyl)-1-pyridin-3-ylsulfonylpiperazine (PubChem CID 124971463) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is (2S)-2-(2-methoxyphenyl)-1-pyridin-3-ylsulfonylpiperazine.
| Compound Name | (2S)-2-(2-methoxyphenyl)-1-pyridin-3-ylsulfonylpiperazine |
|---|---|
| PubChem CID | 124971463 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | (2S)-2-(2-methoxyphenyl)-1-pyridin-3-ylsulfonylpiperazine |
| SMILES | COc1ccccc1[C@H]1CNCCN1S(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C16H19N3O3S/c1-22-16-7-3-2-6-14(16)15-12-18-9-10-19(15)23(20,21)13-5-4-8-17-11-13/h2-8,11,15,18H,9-10,12H2,1H3/t15-/m1/s1 |
| InChIKey | JWOUTWHVGDASLW-OAHLLOKOSA-N |
| XLogP | 1.43 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |