C18H23ClN2O4S — CID 120763094
2-(2-methoxyphenyl)-1-(4-methoxyphenyl)sulfonylpiperazine;hydrochloride (PubChem CID 120763094) has the molecular formula C18H23ClN2O4S and a molecular weight of 398.91 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-1-(4-methoxyphenyl)sulfonylpiperazine;hydrochloride.
| Compound Name | 2-(2-methoxyphenyl)-1-(4-methoxyphenyl)sulfonylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120763094 |
| Molecular Formula | C18H23ClN2O4S |
| Molecular Weight | 398.91 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 2-(2-methoxyphenyl)-1-(4-methoxyphenyl)sulfonylpiperazine;hydrochloride |
| SMILES | COc1ccc(S(=O)(=O)N2CCNCC2c2ccccc2OC)cc1.Cl |
| InChI | InChI=1S/C18H22N2O4S.ClH/c1-23-14-7-9-15(10-8-14)25(21,22)20-12-11-19-13-17(20)16-5-3-4-6-18(16)24-2;/h3-10,17,19H,11-13H2,1-2H3;1H |
| InChIKey | SWSHPPWLIRVADR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.91 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |