C17H22N2O3S2 — CID 120763016
1-(4,5-dimethylthiophen-2-yl)sulfonyl-2-(2-methoxyphenyl)piperazine (PubChem CID 120763016) has the molecular formula C17H22N2O3S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 1-(4,5-dimethylthiophen-2-yl)sulfonyl-2-(2-methoxyphenyl)piperazine.
| Compound Name | 1-(4,5-dimethylthiophen-2-yl)sulfonyl-2-(2-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 120763016 |
| Molecular Formula | C17H22N2O3S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 1-(4,5-dimethylthiophen-2-yl)sulfonyl-2-(2-methoxyphenyl)piperazine |
| SMILES | COc1ccccc1C1CNCCN1S(=O)(=O)c1cc(C)c(C)s1 |
| InChI | InChI=1S/C17H22N2O3S2/c1-12-10-17(23-13(12)2)24(20,21)19-9-8-18-11-15(19)14-6-4-5-7-16(14)22-3/h4-7,10,15,18H,8-9,11H2,1-3H3 |
| InChIKey | XUGNRMJMINLFGR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |