C15H26ClN3O3S — CID 120763279
N,N-diethyl-2-(2-methoxyphenyl)piperazine-1-sulfonamide;hydrochloride (PubChem CID 120763279) has the molecular formula C15H26ClN3O3S and a molecular weight of 363.91 g/mol. Its IUPAC name is N,N-diethyl-2-(2-methoxyphenyl)piperazine-1-sulfonamide;hydrochloride.
| Compound Name | N,N-diethyl-2-(2-methoxyphenyl)piperazine-1-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120763279 |
| Molecular Formula | C15H26ClN3O3S |
| Molecular Weight | 363.91 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | N,N-diethyl-2-(2-methoxyphenyl)piperazine-1-sulfonamide;hydrochloride |
| SMILES | CCN(CC)S(=O)(=O)N1CCNCC1c1ccccc1OC.Cl |
| InChI | InChI=1S/C15H25N3O3S.ClH/c1-4-17(5-2)22(19,20)18-11-10-16-12-14(18)13-8-6-7-9-15(13)21-3;/h6-9,14,16H,4-5,10-12H2,1-3H3;1H |
| InChIKey | YNYWCGPJNHQVSS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.91 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |