C16H25ClN2O4S — CID 120876675
2-(2-methoxyphenyl)-1-(oxan-3-ylsulfonyl)piperazine;hydrochloride (PubChem CID 120876675) has the molecular formula C16H25ClN2O4S and a molecular weight of 376.91 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-1-(oxan-3-ylsulfonyl)piperazine;hydrochloride.
| Compound Name | 2-(2-methoxyphenyl)-1-(oxan-3-ylsulfonyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 120876675 |
| Molecular Formula | C16H25ClN2O4S |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 2-(2-methoxyphenyl)-1-(oxan-3-ylsulfonyl)piperazine;hydrochloride |
| SMILES | COc1ccccc1C1CNCCN1S(=O)(=O)C1CCCOC1.Cl |
| InChI | InChI=1S/C16H24N2O4S.ClH/c1-21-16-7-3-2-6-14(16)15-11-17-8-9-18(15)23(19,20)13-5-4-10-22-12-13;/h2-3,6-7,13,15,17H,4-5,8-12H2,1H3;1H |
| InChIKey | JJDZGFHMEZHBGW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |