C20H30ClN3O3 — CID 120754001
3-[2-(2-methoxyphenyl)piperazin-1-yl]-1-(oxan-4-yl)pyrrolidin-2-one;hydrochloride (PubChem CID 120754001) has the molecular formula C20H30ClN3O3 and a molecular weight of 395.93 g/mol. Its IUPAC name is 3-[2-(2-methoxyphenyl)piperazin-1-yl]-1-(oxan-4-yl)pyrrolidin-2-one;hydrochloride.
| Compound Name | 3-[2-(2-methoxyphenyl)piperazin-1-yl]-1-(oxan-4-yl)pyrrolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 120754001 |
| Molecular Formula | C20H30ClN3O3 |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 3-[2-(2-methoxyphenyl)piperazin-1-yl]-1-(oxan-4-yl)pyrrolidin-2-one;hydrochloride |
| SMILES | COc1ccccc1C1CNCCN1C1CCN(C2CCOCC2)C1=O.Cl |
| InChI | InChI=1S/C20H29N3O3.ClH/c1-25-19-5-3-2-4-16(19)18-14-21-9-11-23(18)17-6-10-22(20(17)24)15-7-12-26-13-8-15;/h2-5,15,17-18,21H,6-14H2,1H3;1H |
| InChIKey | KTCIDXJIDRNEML-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |