C19H26ClN3O2 — CID 120771158
3-[2-(3-chlorophenyl)piperazin-1-yl]-1-(oxan-4-yl)pyrrolidin-2-one (PubChem CID 120771158) has the molecular formula C19H26ClN3O2 and a molecular weight of 363.89 g/mol. Its IUPAC name is 3-[2-(3-chlorophenyl)piperazin-1-yl]-1-(oxan-4-yl)pyrrolidin-2-one.
| Compound Name | 3-[2-(3-chlorophenyl)piperazin-1-yl]-1-(oxan-4-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 120771158 |
| Molecular Formula | C19H26ClN3O2 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 3-[2-(3-chlorophenyl)piperazin-1-yl]-1-(oxan-4-yl)pyrrolidin-2-one |
| SMILES | O=C1C(N2CCNCC2c2cccc(Cl)c2)CCN1C1CCOCC1 |
| InChI | InChI=1S/C19H26ClN3O2/c20-15-3-1-2-14(12-15)18-13-21-7-9-23(18)17-4-8-22(19(17)24)16-5-10-25-11-6-16/h1-3,12,16-18,21H,4-11,13H2 |
| InChIKey | PDHLMCUILGAZJY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |