C20H18ClFN4O6S — CID 173069166
but-2-enedioic acid;1-[5-(2-chloro-3-pyridinyl)-4-fluoro-1-pyridin-3-ylsulfonylpyrrol-3-yl]-N-methylmethanamine (PubChem CID 173069166) has the molecular formula C20H18ClFN4O6S and a molecular weight of 496.90 g/mol. Its IUPAC name is but-2-enedioic acid;1-[5-(2-chloro-3-pyridinyl)-4-fluoro-1-pyridin-3-ylsulfonylpyrrol-3-yl]-N-methylmethanamine.
| Compound Name | but-2-enedioic acid;1-[5-(2-chloro-3-pyridinyl)-4-fluoro-1-pyridin-3-ylsulfonylpyrrol-3-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 173069166 |
| Molecular Formula | C20H18ClFN4O6S |
| Molecular Weight | 496.90 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | but-2-enedioic acid;1-[5-(2-chloro-3-pyridinyl)-4-fluoro-1-pyridin-3-ylsulfonylpyrrol-3-yl]-N-methylmethanamine |
| SMILES | CNCc1cn(S(=O)(=O)c2cccnc2)c(-c2cccnc2Cl)c1F.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C16H14ClFN4O2S.C4H4O4/c1-19-8-11-10-22(25(23,24)12-4-2-6-20-9-12)15(14(11)18)13-5-3-7-21-16(13)17;5-3(6)1-2-4(7)8/h2-7,9-10,19H,8H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | DQZFSSCCPDCXAL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 151.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.90 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|