C22H22FN3O7S — CID 67397796
(E)-but-2-enedioic acid;1-[5-(2-fluoro-3-pyridinyl)-1-(3-methoxyphenyl)sulfonylpyrrol-3-yl]-N-methylmethanamine (PubChem CID 67397796) has the molecular formula C22H22FN3O7S and a molecular weight of 491.50 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-[5-(2-fluoro-3-pyridinyl)-1-(3-methoxyphenyl)sulfonylpyrrol-3-yl]-N-methylmethanamine.
| Compound Name | (E)-but-2-enedioic acid;1-[5-(2-fluoro-3-pyridinyl)-1-(3-methoxyphenyl)sulfonylpyrrol-3-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 67397796 |
| Molecular Formula | C22H22FN3O7S |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | (E)-but-2-enedioic acid;1-[5-(2-fluoro-3-pyridinyl)-1-(3-methoxyphenyl)sulfonylpyrrol-3-yl]-N-methylmethanamine |
| SMILES | CNCc1cc(-c2cccnc2F)n(S(=O)(=O)c2cccc(OC)c2)c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C18H18FN3O3S.C4H4O4/c1-20-11-13-9-17(16-7-4-8-21-18(16)19)22(12-13)26(23,24)15-6-3-5-14(10-15)25-2;5-3(6)1-2-4(7)8/h3-10,12,20H,11H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | FXOPLTOVDOTCGJ-WLHGVMLRSA-N |
| XLogP | 2.37 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|