C19H18FN3O5S — CID 140530795
[5-(2-fluoro-3-pyridinyl)-1-(3-methoxyphenyl)sulfonylpyrrol-3-yl]methyl N-methylcarbamate (PubChem CID 140530795) has the molecular formula C19H18FN3O5S and a molecular weight of 419.43 g/mol. Its IUPAC name is [5-(2-fluoro-3-pyridinyl)-1-(3-methoxyphenyl)sulfonylpyrrol-3-yl]methyl N-methylcarbamate.
| Compound Name | [5-(2-fluoro-3-pyridinyl)-1-(3-methoxyphenyl)sulfonylpyrrol-3-yl]methyl N-methylcarbamate |
|---|---|
| PubChem CID | 140530795 |
| Molecular Formula | C19H18FN3O5S |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | [5-(2-fluoro-3-pyridinyl)-1-(3-methoxyphenyl)sulfonylpyrrol-3-yl]methyl N-methylcarbamate |
| SMILES | CNC(=O)OCc1cc(-c2cccnc2F)n(S(=O)(=O)c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C19H18FN3O5S/c1-21-19(24)28-12-13-9-17(16-7-4-8-22-18(16)20)23(11-13)29(25,26)15-6-3-5-14(10-15)27-2/h3-11H,12H2,1-2H3,(H,21,24) |
| InChIKey | HPWDEQFAZGCSRD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|