C22H22F3N3O4S — CID 67398057
[1-(3,4-difluorophenyl)sulfonyl-5-(2-fluoro-3-pyridinyl)pyrrol-3-yl]methyl-(2,2-dimethylpropyl)carbamic acid (PubChem CID 67398057) has the molecular formula C22H22F3N3O4S and a molecular weight of 481.50 g/mol. Its IUPAC name is [1-(3,4-difluorophenyl)sulfonyl-5-(2-fluoro-3-pyridinyl)pyrrol-3-yl]methyl-(2,2-dimethylpropyl)carbamic acid.
| Compound Name | [1-(3,4-difluorophenyl)sulfonyl-5-(2-fluoro-3-pyridinyl)pyrrol-3-yl]methyl-(2,2-dimethylpropyl)carbamic acid |
|---|---|
| PubChem CID | 67398057 |
| Molecular Formula | C22H22F3N3O4S |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | [1-(3,4-difluorophenyl)sulfonyl-5-(2-fluoro-3-pyridinyl)pyrrol-3-yl]methyl-(2,2-dimethylpropyl)carbamic acid |
| SMILES | CC(C)(C)CN(Cc1cc(-c2cccnc2F)n(S(=O)(=O)c2ccc(F)c(F)c2)c1)C(=O)O |
| InChI | InChI=1S/C22H22F3N3O4S/c1-22(2,3)13-27(21(29)30)11-14-9-19(16-5-4-8-26-20(16)25)28(12-14)33(31,32)15-6-7-17(23)18(24)10-15/h4-10,12H,11,13H2,1-3H3,(H,29,30) |
| InChIKey | HYUFFSKLGFPHLC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|